C19H15ClO6S3 — CID 87164613
6-chloro-3-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethylsulfonyl]thiochromen-2-one (PubChem CID 87164613) has the molecular formula C19H15ClO6S3 and a molecular weight of 470.98 g/mol. Its IUPAC name is 6-chloro-3-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethylsulfonyl]thiochromen-2-one.
| Compound Name | 6-chloro-3-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethylsulfonyl]thiochromen-2-one |
|---|---|
| PubChem CID | 87164613 |
| Molecular Formula | C19H15ClO6S3 |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | 6-chloro-3-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethylsulfonyl]thiochromen-2-one |
| SMILES | COc1ccc(/C=C/S(=O)(=O)CS(=O)(=O)c2cc3cc(Cl)ccc3sc2=O)cc1 |
| InChI | InChI=1S/C19H15ClO6S3/c1-26-16-5-2-13(3-6-16)8-9-28(22,23)12-29(24,25)18-11-14-10-15(20)4-7-17(14)27-19(18)21/h2-11H,12H2,1H3/b9-8+ |
| InChIKey | QZRNDXFDVYDTTP-CMDGGOBGSA-N |
| XLogP | 3.74 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |