C19H15IO6S3 — CID 91249027
7-iodo-3-[2-(4-methoxyphenyl)ethenylsulfonylmethylsulfonyl]thiochromen-2-one (PubChem CID 91249027) has the molecular formula C19H15IO6S3 and a molecular weight of 562.43 g/mol. Its IUPAC name is 7-iodo-3-[2-(4-methoxyphenyl)ethenylsulfonylmethylsulfonyl]thiochromen-2-one.
| Compound Name | 7-iodo-3-[2-(4-methoxyphenyl)ethenylsulfonylmethylsulfonyl]thiochromen-2-one |
|---|---|
| PubChem CID | 91249027 |
| Molecular Formula | C19H15IO6S3 |
| Molecular Weight | 562.43 g/mol |
| Exact Mass | 561.91 |
| IUPAC Name | 7-iodo-3-[2-(4-methoxyphenyl)ethenylsulfonylmethylsulfonyl]thiochromen-2-one |
| SMILES | COc1ccc(C=CS(=O)(=O)CS(=O)(=O)c2cc3ccc(I)cc3sc2=O)cc1 |
| InChI | InChI=1S/C19H15IO6S3/c1-26-16-6-2-13(3-7-16)8-9-28(22,23)12-29(24,25)18-10-14-4-5-15(20)11-17(14)27-19(18)21/h2-11H,12H2,1H3 |
| InChIKey | ITAYOJXXKHVZDY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|