C21H16O8S4 — CID 87164611
7-methoxy-3-[(7-methoxy-2-oxothiochromen-3-yl)sulfonylmethylsulfonyl]thiochromen-2-one (PubChem CID 87164611) has the molecular formula C21H16O8S4 and a molecular weight of 524.62 g/mol. Its IUPAC name is 7-methoxy-3-[(7-methoxy-2-oxothiochromen-3-yl)sulfonylmethylsulfonyl]thiochromen-2-one.
| Compound Name | 7-methoxy-3-[(7-methoxy-2-oxothiochromen-3-yl)sulfonylmethylsulfonyl]thiochromen-2-one |
|---|---|
| PubChem CID | 87164611 |
| Molecular Formula | C21H16O8S4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 7-methoxy-3-[(7-methoxy-2-oxothiochromen-3-yl)sulfonylmethylsulfonyl]thiochromen-2-one |
| SMILES | COc1ccc2cc(S(=O)(=O)CS(=O)(=O)c3cc4ccc(OC)cc4sc3=O)c(=O)sc2c1 |
| InChI | InChI=1S/C21H16O8S4/c1-28-14-5-3-12-7-18(20(22)30-16(12)9-14)32(24,25)11-33(26,27)19-8-13-4-6-15(29-2)10-17(13)31-21(19)23/h3-10H,11H2,1-2H3 |
| InChIKey | NWZOTUZMQBPEKV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |