C20H15IO5S2 — CID 66811427
6-iodo-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one (PubChem CID 66811427) has the molecular formula C20H15IO5S2 and a molecular weight of 526.37 g/mol. Its IUPAC name is 6-iodo-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one.
| Compound Name | 6-iodo-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one |
|---|---|
| PubChem CID | 66811427 |
| Molecular Formula | C20H15IO5S2 |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 525.94 |
| IUPAC Name | 6-iodo-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one |
| SMILES | COc1ccc(/C=C/C(=O)CS(=O)(=O)c2cc3cc(I)ccc3sc2=O)cc1 |
| InChI | InChI=1S/C20H15IO5S2/c1-26-17-7-3-13(4-8-17)2-6-16(22)12-28(24,25)19-11-14-10-15(21)5-9-18(14)27-20(19)23/h2-11H,12H2,1H3/b6-2+ |
| InChIKey | KCEFEVWSROLUGM-QHHAFSJGSA-N |
| XLogP | 3.93 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|