C22H18O5S — CID 67008250
(Z)-1-(5-methoxy-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione (PubChem CID 67008250) has the molecular formula C22H18O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is (Z)-1-(5-methoxy-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione.
| Compound Name | (Z)-1-(5-methoxy-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 67008250 |
| Molecular Formula | C22H18O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (Z)-1-(5-methoxy-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
| SMILES | COc1ccc(/C=C\C(=O)CC(=O)c2cc3c(OC)cccc3sc2=O)cc1 |
| InChI | InChI=1S/C22H18O5S/c1-26-16-10-7-14(8-11-16)6-9-15(23)12-19(24)17-13-18-20(27-2)4-3-5-21(18)28-22(17)25/h3-11,13H,12H2,1-2H3/b9-6- |
| InChIKey | PUVFEBOAYUCCCH-TWGQIWQCSA-N |
| XLogP | 4.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|