C21H15ClO4S — CID 12000760
(E)-1-(6-chloro-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione (PubChem CID 12000760) has the molecular formula C21H15ClO4S and a molecular weight of 398.87 g/mol. Its IUPAC name is (E)-1-(6-chloro-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione.
| Compound Name | (E)-1-(6-chloro-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 12000760 |
| Molecular Formula | C21H15ClO4S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (E)-1-(6-chloro-2-oxothiochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
| SMILES | COc1ccc(/C=C/C(=O)CC(=O)c2cc3cc(Cl)ccc3sc2=O)cc1 |
| InChI | InChI=1S/C21H15ClO4S/c1-26-17-7-3-13(4-8-17)2-6-16(23)12-19(24)18-11-14-10-15(22)5-9-20(14)27-21(18)25/h2-11H,12H2,1H3/b6-2+ |
| InChIKey | PFUNCYZEGTVBQF-QHHAFSJGSA-N |
| XLogP | 4.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|