C21H16ClNO4 — CID 67007967
(Z)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione (PubChem CID 67007967) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is (Z)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione.
| Compound Name | (Z)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 67007967 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (Z)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
| SMILES | COc1ccc(/C=C\C(=O)CC(=O)c2cc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H16ClNO4/c1-27-17-8-3-13(4-9-17)2-7-16(24)12-20(25)18-10-14-5-6-15(22)11-19(14)23-21(18)26/h2-11H,12H2,1H3,(H,23,26)/b7-2- |
| InChIKey | LRXLKAUNWQZUAG-UQCOIBPSSA-N |
| XLogP | 4.05 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|