C20H14Cl2N2O3 — CID 67008419
(E)-5-(3-amino-4-chlorophenyl)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)pent-4-ene-1,3-dione (PubChem CID 67008419) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is (E)-5-(3-amino-4-chlorophenyl)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)pent-4-ene-1,3-dione.
| Compound Name | (E)-5-(3-amino-4-chlorophenyl)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 67008419 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (E)-5-(3-amino-4-chlorophenyl)-1-(7-chloro-2-oxo-1H-quinolin-3-yl)pent-4-ene-1,3-dione |
| SMILES | Nc1cc(/C=C/C(=O)CC(=O)c2cc3ccc(Cl)cc3[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-13-4-3-12-8-15(20(27)24-18(12)9-13)19(26)10-14(25)5-1-11-2-6-16(22)17(23)7-11/h1-9H,10,23H2,(H,24,27)/b5-1+ |
| InChIKey | WKPCAVKSXPORBS-ORCRQEGFSA-N |
| XLogP | 4.27 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|