C20H16ClNO5S — CID 66811306
7-chloro-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one (PubChem CID 66811306) has the molecular formula C20H16ClNO5S and a molecular weight of 417.87 g/mol. Its IUPAC name is 7-chloro-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one.
| Compound Name | 7-chloro-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 66811306 |
| Molecular Formula | C20H16ClNO5S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 7-chloro-3-[(E)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one |
| SMILES | COc1ccc(/C=C/C(=O)CS(=O)(=O)c2cc3ccc(Cl)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H16ClNO5S/c1-27-17-8-3-13(4-9-17)2-7-16(23)12-28(25,26)19-10-14-5-6-15(21)11-18(14)22-20(19)24/h2-11H,12H2,1H3,(H,22,24)/b7-2+ |
| InChIKey | GYTSVOKBWRESFL-FARCUNLSSA-N |
| XLogP | 3.25 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|