C19H12Cl2N2O6S — CID 66811227
7-chloro-3-[4-(4-chloro-3-nitrophenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one (PubChem CID 66811227) has the molecular formula C19H12Cl2N2O6S and a molecular weight of 467.29 g/mol. Its IUPAC name is 7-chloro-3-[4-(4-chloro-3-nitrophenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one.
| Compound Name | 7-chloro-3-[4-(4-chloro-3-nitrophenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 66811227 |
| Molecular Formula | C19H12Cl2N2O6S |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 7-chloro-3-[4-(4-chloro-3-nitrophenyl)-2-oxobut-3-enyl]sulfonyl-1H-quinolin-2-one |
| SMILES | O=C(C=Cc1ccc(Cl)c([N+](=O)[O-])c1)CS(=O)(=O)c1cc2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C19H12Cl2N2O6S/c20-13-4-3-12-8-18(19(25)22-16(12)9-13)30(28,29)10-14(24)5-1-11-2-6-15(21)17(7-11)23(26)27/h1-9H,10H2,(H,22,25) |
| InChIKey | MUOVJWNDSSLSGO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|