C25H24O7 — CID 87235002
(E)-1-(5,7-diethoxy-2-oxochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione (PubChem CID 87235002) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is (E)-1-(5,7-diethoxy-2-oxochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione.
| Compound Name | (E)-1-(5,7-diethoxy-2-oxochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 87235002 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (E)-1-(5,7-diethoxy-2-oxochromen-3-yl)-5-(4-methoxyphenyl)pent-4-ene-1,3-dione |
| SMILES | CCOc1cc(OCC)c2cc(C(=O)CC(=O)/C=C/c3ccc(OC)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H24O7/c1-4-30-19-13-23(31-5-2)21-15-20(25(28)32-24(21)14-19)22(27)12-17(26)9-6-16-7-10-18(29-3)11-8-16/h6-11,13-15H,4-5,12H2,1-3H3/b9-6+ |
| InChIKey | MCNOFFIMMLEYCX-RMKNXTFCSA-N |
| XLogP | 4.45 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|