C26H27Br3O9 — CID 158403015
3-bromo-4,5-dimethoxybenzaldehyde;3-bromo-4-hydroxy-5-methoxybenzaldehyde;1-bromo-2,3,5-trimethoxybenzene (PubChem CID 158403015) has the molecular formula C26H27Br3O9 and a molecular weight of 723.21 g/mol. Its IUPAC name is 3-bromo-4,5-dimethoxybenzaldehyde;3-bromo-4-hydroxy-5-methoxybenzaldehyde;1-bromo-2,3,5-trimethoxybenzene.
| Compound Name | 3-bromo-4,5-dimethoxybenzaldehyde;3-bromo-4-hydroxy-5-methoxybenzaldehyde;1-bromo-2,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 158403015 |
| Molecular Formula | C26H27Br3O9 |
| Molecular Weight | 723.21 g/mol |
| Exact Mass | 719.92 |
| IUPAC Name | 3-bromo-4,5-dimethoxybenzaldehyde;3-bromo-4-hydroxy-5-methoxybenzaldehyde;1-bromo-2,3,5-trimethoxybenzene |
| SMILES | COc1cc(Br)c(OC)c(OC)c1.COc1cc(C=O)cc(Br)c1O.COc1cc(C=O)cc(Br)c1OC |
| InChI | InChI=1S/C9H11BrO3.C9H9BrO3.C8H7BrO3/c1-11-6-4-7(10)9(13-3)8(5-6)12-2;1-12-8-4-6(5-11)3-7(10)9(8)13-2;1-12-7-3-5(4-10)2-6(9)8(7)11/h4-5H,1-3H3;3-5H,1-2H3;2-4,11H,1H3 |
| InChIKey | GYIJBLDEDGYLLU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.21 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|