C14H10Br2O3 — CID 86660065
3,5-dibromo-4-(4-methoxyphenoxy)benzaldehyde (PubChem CID 86660065) has the molecular formula C14H10Br2O3 and a molecular weight of 386.04 g/mol. Its IUPAC name is 3,5-dibromo-4-(4-methoxyphenoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(4-methoxyphenoxy)benzaldehyde |
|---|---|
| PubChem CID | 86660065 |
| Molecular Formula | C14H10Br2O3 |
| Molecular Weight | 386.04 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | 3,5-dibromo-4-(4-methoxyphenoxy)benzaldehyde |
| SMILES | COc1ccc(Oc2c(Br)cc(C=O)cc2Br)cc1 |
| InChI | InChI=1S/C14H10Br2O3/c1-18-10-2-4-11(5-3-10)19-14-12(15)6-9(8-17)7-13(14)16/h2-8H,1H3 |
| InChIKey | KPYWAKCFAXPNQN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.04 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|