C24H24N2O5 — CID 4964394
2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 4964394) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 4964394 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1cc(OC)c2c(C)c(CC(=O)NCCc3c[nH]c4ccccc34)c(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O5/c1-14-18(24(28)31-21-11-16(29-2)10-20(30-3)23(14)21)12-22(27)25-9-8-15-13-26-19-7-5-4-6-17(15)19/h4-7,10-11,13,26H,8-9,12H2,1-3H3,(H,25,27) |
| InChIKey | OOFINGSIAMQRHH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|