C32H28N2O5 — CID 154925442
N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide (PubChem CID 154925442) has the molecular formula C32H28N2O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide |
|---|---|
| PubChem CID | 154925442 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide |
| SMILES | COc1ccc(-c2oc3c(c(C)cc4oc(=O)cc(C)c43)c2CC(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C32H28N2O5/c1-18-14-26-30(19(2)15-28(36)38-26)32-29(18)24(31(39-32)20-8-10-22(37-3)11-9-20)16-27(35)33-13-12-21-17-34-25-7-5-4-6-23(21)25/h4-11,14-15,17,34H,12-13,16H2,1-3H3,(H,33,35) |
| InChIKey | WIRZTQFEFSQMEH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|