C24H24N2O5 — CID 8016363
2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 8016363) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8016363 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)Cc3c(C)c4ccc(O)c(C)c4oc3=O)c2c1 |
| InChI | InChI=1S/C24H24N2O5/c1-13-17-5-7-21(27)14(2)23(17)31-24(29)18(13)11-22(28)25-9-8-15-12-26-20-6-4-16(30-3)10-19(15)20/h4-7,10,12,26-27H,8-9,11H2,1-3H3,(H,25,28) |
| InChIKey | VBRKONHXGFTUIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|