C22H21NO7 — CID 4303543
2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid (PubChem CID 4303543) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 4303543 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid |
| SMILES | COc1cc(OC)c2c(C)c(CC(=O)NC(C(=O)O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO7/c1-12-15(11-18(24)23-20(21(25)26)13-7-5-4-6-8-13)22(27)30-17-10-14(28-2)9-16(29-3)19(12)17/h4-10,20H,11H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | QIMKNHWXFSGMCZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|