C26H18O6 — CID 54720917
2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]indene-1,3-dione (PubChem CID 54720917) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]indene-1,3-dione.
| Compound Name | 2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]indene-1,3-dione |
|---|---|
| PubChem CID | 54720917 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]indene-1,3-dione |
| SMILES | COc1cccc(C(c2c(O)c3ccccc3oc2=O)C2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C26H18O6/c1-31-15-8-6-7-14(13-15)20(21-23(27)16-9-2-3-10-17(16)24(21)28)22-25(29)18-11-4-5-12-19(18)32-26(22)30/h2-13,20-21,29H,1H3 |
| InChIKey | PNSAOHMCTILVOV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|