C35H30N2O6 — CID 54695281
N-[2-[2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]-1H-indol-3-yl]ethyl]-2-methoxybenzamide (PubChem CID 54695281) has the molecular formula C35H30N2O6 and a molecular weight of 574.63 g/mol. Its IUPAC name is N-[2-[2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]-1H-indol-3-yl]ethyl]-2-methoxybenzamide.
| Compound Name | N-[2-[2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]-1H-indol-3-yl]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 54695281 |
| Molecular Formula | C35H30N2O6 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | N-[2-[2-[(4-hydroxy-2-oxochromen-3-yl)-(3-methoxyphenyl)methyl]-1H-indol-3-yl]ethyl]-2-methoxybenzamide |
| SMILES | COc1cccc(C(c2[nH]c3ccccc3c2CCNC(=O)c2ccccc2OC)c2c(O)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C35H30N2O6/c1-41-22-11-9-10-21(20-22)30(31-33(38)25-13-4-8-17-29(25)43-35(31)40)32-24(23-12-3-6-15-27(23)37-32)18-19-36-34(39)26-14-5-7-16-28(26)42-2/h3-17,20,30,37-38H,18-19H2,1-2H3,(H,36,39) |
| InChIKey | AVNWWKNFJCUAAU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|