C18H26Cl2O2 — CID 125471168
(4S,5S,8R,9S,10R,13S,14S,17S)-4,5-dichloro-17-hydroxy-13-methyl-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 125471168) has the molecular formula C18H26Cl2O2 and a molecular weight of 345.31 g/mol. Its IUPAC name is (4S,5S,8R,9S,10R,13S,14S,17S)-4,5-dichloro-17-hydroxy-13-methyl-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (4S,5S,8R,9S,10R,13S,14S,17S)-4,5-dichloro-17-hydroxy-13-methyl-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 125471168 |
| Molecular Formula | C18H26Cl2O2 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4S,5S,8R,9S,10R,13S,14S,17S)-4,5-dichloro-17-hydroxy-13-methyl-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@]4(Cl)[C@@H]3CCC(=O)[C@@H]4Cl)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C18H26Cl2O2/c1-17-8-6-11-10(12(17)3-5-15(17)22)7-9-18(20)13(11)2-4-14(21)16(18)19/h10-13,15-16,22H,2-9H2,1H3/t10-,11+,12+,13-,15+,16+,17+,18+/m1/s1 |
| InChIKey | WEKMAVMWJMVTHD-IHJGYEBDSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|