C15H22O2 — CID 125113704
(1aR,3aR,7R,7aS,7bS)-1,1,3a,7-tetramethyl-3,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-2,4-dione (PubChem CID 125113704) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1aR,3aR,7R,7aS,7bS)-1,1,3a,7-tetramethyl-3,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-2,4-dione.
| Compound Name | (1aR,3aR,7R,7aS,7bS)-1,1,3a,7-tetramethyl-3,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-2,4-dione |
|---|---|
| PubChem CID | 125113704 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1aR,3aR,7R,7aS,7bS)-1,1,3a,7-tetramethyl-3,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[a]naphthalene-2,4-dione |
| SMILES | C[C@@H]1CCC(=O)[C@]2(C)CC(=O)[C@@H]3[C@H]([C@H]12)C3(C)C |
| InChI | InChI=1S/C15H22O2/c1-8-5-6-10(17)15(4)7-9(16)12-13(11(8)15)14(12,2)3/h8,11-13H,5-7H2,1-4H3/t8-,11+,12-,13+,15+/m1/s1 |
| InChIKey | BVVNDRXJWUAYST-IJSHJKMVSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |