C20H34O4 — CID 10735767
(4aS,5R,8aS)-1,1,4a-trimethyl-6-methylidene-5-[(4R)-3,4,5-trihydroxy-3-methylpentyl]-3,4,5,7,8,8a-hexahydronaphthalen-2-one (PubChem CID 10735767) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (4aS,5R,8aS)-1,1,4a-trimethyl-6-methylidene-5-[(4R)-3,4,5-trihydroxy-3-methylpentyl]-3,4,5,7,8,8a-hexahydronaphthalen-2-one.
| Compound Name | (4aS,5R,8aS)-1,1,4a-trimethyl-6-methylidene-5-[(4R)-3,4,5-trihydroxy-3-methylpentyl]-3,4,5,7,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10735767 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (4aS,5R,8aS)-1,1,4a-trimethyl-6-methylidene-5-[(4R)-3,4,5-trihydroxy-3-methylpentyl]-3,4,5,7,8,8a-hexahydronaphthalen-2-one |
| SMILES | C=C1CC[C@@H]2C(C)(C)C(=O)CC[C@@]2(C)[C@@H]1CCC(C)(O)[C@H](O)CO |
| InChI | InChI=1S/C20H34O4/c1-13-6-7-15-18(2,3)16(22)9-10-19(15,4)14(13)8-11-20(5,24)17(23)12-21/h14-15,17,21,23-24H,1,6-12H2,2-5H3/t14-,15-,17-,19+,20?/m1/s1 |
| InChIKey | HJEKXLRWHIPFOH-TVSOLFLYSA-N |
| XLogP | 2.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|