C15H18BrNO4 — CID 102552786
N-[2-(4-bromophenoxy)ethyl]-2,2-dimethyl-5-oxooxolane-3-carboxamide (PubChem CID 102552786) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is N-[2-(4-bromophenoxy)ethyl]-2,2-dimethyl-5-oxooxolane-3-carboxamide.
| Compound Name | N-[2-(4-bromophenoxy)ethyl]-2,2-dimethyl-5-oxooxolane-3-carboxamide |
|---|---|
| PubChem CID | 102552786 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[2-(4-bromophenoxy)ethyl]-2,2-dimethyl-5-oxooxolane-3-carboxamide |
| SMILES | CC1(C)OC(=O)CC1C(=O)NCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrNO4/c1-15(2)12(9-13(18)21-15)14(19)17-7-8-20-11-5-3-10(16)4-6-11/h3-6,12H,7-9H2,1-2H3,(H,17,19) |
| InChIKey | NFQLLTYJBXSTNC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|