C22H27N3O3S — CID 59167647
[(Z)-[2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropylidene]amino] N-phenylcarbamate (PubChem CID 59167647) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is [(Z)-[2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropylidene]amino] N-phenylcarbamate.
| Compound Name | [(Z)-[2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropylidene]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 59167647 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [(Z)-[2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropylidene]amino] N-phenylcarbamate |
| SMILES | CSc1ccc(/C(=N/OC(=O)Nc2ccccc2)C(C)(C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-22(2,25-13-15-27-16-14-25)20(17-9-11-19(29-3)12-10-17)24-28-21(26)23-18-7-5-4-6-8-18/h4-12H,13-16H2,1-3H3,(H,23,26)/b24-20- |
| InChIKey | IUABAXTYBGRKQT-GFMRDNFCSA-N |
| XLogP | 4.47 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|