C20H31N3O4 — CID 17476807
tert-butyl N-[4-[(2-methyl-2-morpholin-4-ylpropyl)carbamoyl]phenyl]carbamate (PubChem CID 17476807) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-methyl-2-morpholin-4-ylpropyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-methyl-2-morpholin-4-ylpropyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 17476807 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | tert-butyl N-[4-[(2-methyl-2-morpholin-4-ylpropyl)carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)NCC(C)(C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H31N3O4/c1-19(2,3)27-18(25)22-16-8-6-15(7-9-16)17(24)21-14-20(4,5)23-10-12-26-13-11-23/h6-9H,10-14H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | SFUBCFWTVFBGNG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |