C19H31N5O3 — CID 111314262
methyl N-[4-[[[N'-methyl-N-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]phenyl]carbamate (PubChem CID 111314262) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is methyl N-[4-[[[N'-methyl-N-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[N'-methyl-N-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111314262 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | methyl N-[4-[[[N'-methyl-N-(2-methyl-2-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]phenyl]carbamate |
| SMILES | C/N=C(/NCc1ccc(NC(=O)OC)cc1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C19H31N5O3/c1-19(2,24-9-11-27-12-10-24)14-22-17(20-3)21-13-15-5-7-16(8-6-15)23-18(25)26-4/h5-8H,9-14H2,1-4H3,(H,23,25)(H2,20,21,22) |
| InChIKey | YWKTUORKNYXREN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|