C18H31N5O3S — CID 111313842
2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111313842) has the molecular formula C18H31N5O3S and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111313842 |
| Molecular Formula | C18H31N5O3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC)cc1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C18H31N5O3S/c1-18(2,23-9-11-26-12-10-23)14-22-17(19-3)21-13-15-5-7-16(8-6-15)27(24,25)20-4/h5-8,20H,9-14H2,1-4H3,(H2,19,21,22) |
| InChIKey | HXGZQTDKXIGEBZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|