C23H39N2O5PS — CID 89128632
N-(1-diethoxyphosphorylpropoxy)-2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylbutan-1-imine (PubChem CID 89128632) has the molecular formula C23H39N2O5PS and a molecular weight of 486.62 g/mol. Its IUPAC name is N-(1-diethoxyphosphorylpropoxy)-2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylbutan-1-imine.
| Compound Name | N-(1-diethoxyphosphorylpropoxy)-2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylbutan-1-imine |
|---|---|
| PubChem CID | 89128632 |
| Molecular Formula | C23H39N2O5PS |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-(1-diethoxyphosphorylpropoxy)-2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylbutan-1-imine |
| SMILES | CCOP(=O)(OCC)C(CC)ON=C(c1ccc(SC)cc1)C(C)(CC)N1CCOCC1 |
| InChI | InChI=1S/C23H39N2O5PS/c1-7-21(31(26,28-9-3)29-10-4)30-24-22(19-11-13-20(32-6)14-12-19)23(5,8-2)25-15-17-27-18-16-25/h11-14,21H,7-10,15-18H2,1-6H3 |
| InChIKey | YWUISOWBOSFEKE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|