C24H28N2O4 — CID 101246835
trans-(3S,5S)-1,3,5-trimethyl-3,5-bis(phenylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 101246835) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is trans-(3S,5S)-1,3,5-trimethyl-3,5-bis(phenylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(3S,5S)-1,3,5-trimethyl-3,5-bis(phenylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 101246835 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | trans-(3S,5S)-1,3,5-trimethyl-3,5-bis(phenylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)C[C@@](C)(C(=O)Nc2ccccc2)C[C@](C)(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O4/c1-22(19(27)25-17-10-6-4-7-11-17)14-23(2,16-24(3,15-22)21(29)30)20(28)26-18-12-8-5-9-13-18/h4-13H,14-16H2,1-3H3,(H,25,27)(H,26,28)(H,29,30)/t22-,23-/m0/s1 |
| InChIKey | GTVGJUPBBZLBTB-GOTSBHOMSA-N |
| XLogP | 4.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |