C15H15NO4S — CID 137119518
3-hydroxy-1-methyl-5-oxo-4-(phenylcarbamothioyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 137119518) has the molecular formula C15H15NO4S and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-5-oxo-4-(phenylcarbamothioyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 3-hydroxy-1-methyl-5-oxo-4-(phenylcarbamothioyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 137119518 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-hydroxy-1-methyl-5-oxo-4-(phenylcarbamothioyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CC(=O)C(C(=S)Nc2ccccc2)=C(O)C1 |
| InChI | InChI=1S/C15H15NO4S/c1-15(14(19)20)7-10(17)12(11(18)8-15)13(21)16-9-5-3-2-4-6-9/h2-6,17H,7-8H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | NISMGYMBFFETPQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|