C22H23FN2OS — CID 1319331
2-(benzylamino)-N-(4-fluorophenyl)-4,4-dimethyl-6-oxocyclohexene-1-carbothioamide (PubChem CID 1319331) has the molecular formula C22H23FN2OS and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-(benzylamino)-N-(4-fluorophenyl)-4,4-dimethyl-6-oxocyclohexene-1-carbothioamide.
| Compound Name | 2-(benzylamino)-N-(4-fluorophenyl)-4,4-dimethyl-6-oxocyclohexene-1-carbothioamide |
|---|---|
| PubChem CID | 1319331 |
| Molecular Formula | C22H23FN2OS |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-(benzylamino)-N-(4-fluorophenyl)-4,4-dimethyl-6-oxocyclohexene-1-carbothioamide |
| SMILES | CC1(C)CC(=O)C(C(=S)Nc2ccc(F)cc2)=C(NCc2ccccc2)C1 |
| InChI | InChI=1S/C22H23FN2OS/c1-22(2)12-18(24-14-15-6-4-3-5-7-15)20(19(26)13-22)21(27)25-17-10-8-16(23)9-11-17/h3-11,24H,12-14H2,1-2H3,(H,25,27) |
| InChIKey | YHKFQAWTXCYQCR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|