C20H18F3N3OS — CID 118606718
6-oxo-N-phenyl-2-(pyridin-4-ylmethylamino)-4-(trifluoromethyl)cyclohexene-1-carbothioamide (PubChem CID 118606718) has the molecular formula C20H18F3N3OS and a molecular weight of 405.45 g/mol. Its IUPAC name is 6-oxo-N-phenyl-2-(pyridin-4-ylmethylamino)-4-(trifluoromethyl)cyclohexene-1-carbothioamide.
| Compound Name | 6-oxo-N-phenyl-2-(pyridin-4-ylmethylamino)-4-(trifluoromethyl)cyclohexene-1-carbothioamide |
|---|---|
| PubChem CID | 118606718 |
| Molecular Formula | C20H18F3N3OS |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 6-oxo-N-phenyl-2-(pyridin-4-ylmethylamino)-4-(trifluoromethyl)cyclohexene-1-carbothioamide |
| SMILES | O=C1CC(C(F)(F)F)CC(NCc2ccncc2)=C1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H18F3N3OS/c21-20(22,23)14-10-16(25-12-13-6-8-24-9-7-13)18(17(27)11-14)19(28)26-15-4-2-1-3-5-15/h1-9,14,25H,10-12H2,(H,26,28) |
| InChIKey | YRHDJYPDRSHTEC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|