C19H16F3N3OS2 — CID 129246328
5-oxo-N-phenyl-3-[[3-(trifluoromethyl)-4-pyridinyl]methylamino]-2H-thiopyran-4-carbothioamide (PubChem CID 129246328) has the molecular formula C19H16F3N3OS2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 5-oxo-N-phenyl-3-[[3-(trifluoromethyl)-4-pyridinyl]methylamino]-2H-thiopyran-4-carbothioamide.
| Compound Name | 5-oxo-N-phenyl-3-[[3-(trifluoromethyl)-4-pyridinyl]methylamino]-2H-thiopyran-4-carbothioamide |
|---|---|
| PubChem CID | 129246328 |
| Molecular Formula | C19H16F3N3OS2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 5-oxo-N-phenyl-3-[[3-(trifluoromethyl)-4-pyridinyl]methylamino]-2H-thiopyran-4-carbothioamide |
| SMILES | O=C1CSCC(NCc2ccncc2C(F)(F)F)=C1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H16F3N3OS2/c20-19(21,22)14-9-23-7-6-12(14)8-24-15-10-28-11-16(26)17(15)18(27)25-13-4-2-1-3-5-13/h1-7,9,24H,8,10-11H2,(H,25,27) |
| InChIKey | VKVJAOFLYRRLCY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|