C21H20FN3OS — CID 118613437
5-[(3-fluoro-4-pyridinyl)methylamino]-7-oxo-N-phenylspiro[2.5]oct-5-ene-6-carbothioamide (PubChem CID 118613437) has the molecular formula C21H20FN3OS and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-[(3-fluoro-4-pyridinyl)methylamino]-7-oxo-N-phenylspiro[2.5]oct-5-ene-6-carbothioamide.
| Compound Name | 5-[(3-fluoro-4-pyridinyl)methylamino]-7-oxo-N-phenylspiro[2.5]oct-5-ene-6-carbothioamide |
|---|---|
| PubChem CID | 118613437 |
| Molecular Formula | C21H20FN3OS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 5-[(3-fluoro-4-pyridinyl)methylamino]-7-oxo-N-phenylspiro[2.5]oct-5-ene-6-carbothioamide |
| SMILES | O=C1CC2(CC2)CC(NCc2ccncc2F)=C1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C21H20FN3OS/c22-16-13-23-9-6-14(16)12-24-17-10-21(7-8-21)11-18(26)19(17)20(27)25-15-4-2-1-3-5-15/h1-6,9,13,24H,7-8,10-12H2,(H,25,27) |
| InChIKey | FKJDBWHTJIXTOJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|