C25H30N4O3S — CID 134582046
tert-butyl N-[[5-oxo-4-(phenylcarbamothioyl)-3-(pyridin-4-ylmethylamino)cyclohex-3-en-1-yl]methyl]carbamate (PubChem CID 134582046) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is tert-butyl N-[[5-oxo-4-(phenylcarbamothioyl)-3-(pyridin-4-ylmethylamino)cyclohex-3-en-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-oxo-4-(phenylcarbamothioyl)-3-(pyridin-4-ylmethylamino)cyclohex-3-en-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 134582046 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | tert-butyl N-[[5-oxo-4-(phenylcarbamothioyl)-3-(pyridin-4-ylmethylamino)cyclohex-3-en-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CC(=O)C(C(=S)Nc2ccccc2)=C(NCc2ccncc2)C1 |
| InChI | InChI=1S/C25H30N4O3S/c1-25(2,3)32-24(31)28-16-18-13-20(27-15-17-9-11-26-12-10-17)22(21(30)14-18)23(33)29-19-7-5-4-6-8-19/h4-12,18,27H,13-16H2,1-3H3,(H,28,31)(H,29,33) |
| InChIKey | ZTJLNGUBNGCEQJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|