C23H25ClN4O3S — CID 129246551
tert-butyl 3-[(3-chloro-4-pyridinyl)methylamino]-5-oxo-4-(phenylcarbamothioyl)-2,6-dihydropyridine-1-carboxylate (PubChem CID 129246551) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is tert-butyl 3-[(3-chloro-4-pyridinyl)methylamino]-5-oxo-4-(phenylcarbamothioyl)-2,6-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-chloro-4-pyridinyl)methylamino]-5-oxo-4-(phenylcarbamothioyl)-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 129246551 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | tert-butyl 3-[(3-chloro-4-pyridinyl)methylamino]-5-oxo-4-(phenylcarbamothioyl)-2,6-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C(C(=S)Nc2ccccc2)=C(NCc2ccncc2Cl)C1 |
| InChI | InChI=1S/C23H25ClN4O3S/c1-23(2,3)31-22(30)28-13-18(26-11-15-9-10-25-12-17(15)24)20(19(29)14-28)21(32)27-16-7-5-4-6-8-16/h4-10,12,26H,11,13-14H2,1-3H3,(H,27,32) |
| InChIKey | YXTUPSLROFEZFD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|