C19H24N2O4S — CID 162686940
tert-butyl 3-ethyl-4-hydroxy-6-oxo-5-(phenylcarbamothioyl)-2,3-dihydropyridine-1-carboxylate (PubChem CID 162686940) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is tert-butyl 3-ethyl-4-hydroxy-6-oxo-5-(phenylcarbamothioyl)-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 3-ethyl-4-hydroxy-6-oxo-5-(phenylcarbamothioyl)-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 162686940 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | tert-butyl 3-ethyl-4-hydroxy-6-oxo-5-(phenylcarbamothioyl)-2,3-dihydropyridine-1-carboxylate |
| SMILES | CCC1CN(C(=O)OC(C)(C)C)C(=O)C(C(=S)Nc2ccccc2)=C1O |
| InChI | InChI=1S/C19H24N2O4S/c1-5-12-11-21(18(24)25-19(2,3)4)17(23)14(15(12)22)16(26)20-13-9-7-6-8-10-13/h6-10,12,22H,5,11H2,1-4H3,(H,20,26) |
| InChIKey | GMGUJRJTBGLLCC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|