C12H19NO4 — CID 86307698
tert-butyl (5S)-5-ethyl-2,4-dioxopiperidine-1-carboxylate (PubChem CID 86307698) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl (5S)-5-ethyl-2,4-dioxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-ethyl-2,4-dioxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86307698 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl (5S)-5-ethyl-2,4-dioxopiperidine-1-carboxylate |
| SMILES | CC[C@H]1CN(C(=O)OC(C)(C)C)C(=O)CC1=O |
| InChI | InChI=1S/C12H19NO4/c1-5-8-7-13(10(15)6-9(8)14)11(16)17-12(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | KNXSCLVWCAEWDH-QMMMGPOBSA-N |
| XLogP | 1.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|