C12H18N2O3 — CID 19753272
tert-butyl 4-methyl-2-oxo-3-prop-2-ynylimidazolidine-1-carboxylate (PubChem CID 19753272) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is tert-butyl 4-methyl-2-oxo-3-prop-2-ynylimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-2-oxo-3-prop-2-ynylimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 19753272 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | tert-butyl 4-methyl-2-oxo-3-prop-2-ynylimidazolidine-1-carboxylate |
| SMILES | C#CCN1C(=O)N(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C12H18N2O3/c1-6-7-13-9(2)8-14(10(13)15)11(16)17-12(3,4)5/h1,9H,7-8H2,2-5H3 |
| InChIKey | IBBJZWUGDOEWSN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|