C13H23N3O2 — CID 121316996
tert-butyl (2S,6R)-4-(cyanomethyl)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 121316996) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-(cyanomethyl)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-(cyanomethyl)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 121316996 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | tert-butyl (2S,6R)-4-(cyanomethyl)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(CC#N)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23N3O2/c1-10-8-15(7-6-14)9-11(2)16(10)12(17)18-13(3,4)5/h10-11H,7-9H2,1-5H3/t10-,11+ |
| InChIKey | JDNMUYITIHOJGC-PHIMTYICSA-N |
| XLogP | 1.84 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|