C14H25N3O3 — CID 112544813
tert-butyl N-[1-(cyanomethyl)-5-(1-hydroxyethyl)piperidin-3-yl]carbamate (PubChem CID 112544813) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[1-(cyanomethyl)-5-(1-hydroxyethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(cyanomethyl)-5-(1-hydroxyethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 112544813 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | tert-butyl N-[1-(cyanomethyl)-5-(1-hydroxyethyl)piperidin-3-yl]carbamate |
| SMILES | CC(O)C1CC(NC(=O)OC(C)(C)C)CN(CC#N)C1 |
| InChI | InChI=1S/C14H25N3O3/c1-10(18)11-7-12(9-17(8-11)6-5-15)16-13(19)20-14(2,3)4/h10-12,18H,6-9H2,1-4H3,(H,16,19) |
| InChIKey | QSWOSSRKMIQPGC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|