C12H21N3O3 — CID 112543535
methyl N-[1-(cyanomethyl)-5-(1-hydroxypropyl)piperidin-3-yl]carbamate (PubChem CID 112543535) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is methyl N-[1-(cyanomethyl)-5-(1-hydroxypropyl)piperidin-3-yl]carbamate.
| Compound Name | methyl N-[1-(cyanomethyl)-5-(1-hydroxypropyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 112543535 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | methyl N-[1-(cyanomethyl)-5-(1-hydroxypropyl)piperidin-3-yl]carbamate |
| SMILES | CCC(O)C1CC(NC(=O)OC)CN(CC#N)C1 |
| InChI | InChI=1S/C12H21N3O3/c1-3-11(16)9-6-10(14-12(17)18-2)8-15(7-9)5-4-13/h9-11,16H,3,5-8H2,1-2H3,(H,14,17) |
| InChIKey | LVTAYRYABIXMRX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|