C12H19N3O4 — CID 112543529
methyl 2-[1-(cyanomethyl)-5-(methoxycarbonylamino)piperidin-3-yl]acetate (PubChem CID 112543529) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 2-[1-(cyanomethyl)-5-(methoxycarbonylamino)piperidin-3-yl]acetate.
| Compound Name | methyl 2-[1-(cyanomethyl)-5-(methoxycarbonylamino)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 112543529 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 2-[1-(cyanomethyl)-5-(methoxycarbonylamino)piperidin-3-yl]acetate |
| SMILES | COC(=O)CC1CC(NC(=O)OC)CN(CC#N)C1 |
| InChI | InChI=1S/C12H19N3O4/c1-18-11(16)6-9-5-10(14-12(17)19-2)8-15(7-9)4-3-13/h9-10H,4-8H2,1-2H3,(H,14,17) |
| InChIKey | MFWKJFVEEDHAQI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|