C15H29N3O — CID 83995432
2-[3-(2,2-dimethylpropylamino)-5-(1-hydroxypropyl)piperidin-1-yl]acetonitrile (PubChem CID 83995432) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropylamino)-5-(1-hydroxypropyl)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[3-(2,2-dimethylpropylamino)-5-(1-hydroxypropyl)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 83995432 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 2-[3-(2,2-dimethylpropylamino)-5-(1-hydroxypropyl)piperidin-1-yl]acetonitrile |
| SMILES | CCC(O)C1CC(NCC(C)(C)C)CN(CC#N)C1 |
| InChI | InChI=1S/C15H29N3O/c1-5-14(19)12-8-13(17-11-15(2,3)4)10-18(9-12)7-6-16/h12-14,17,19H,5,7-11H2,1-4H3 |
| InChIKey | FYYSHXRYFFCQBQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|