C13H23F2N3O — CID 83993358
2-[3-(2,2-difluoroethylamino)-5-(2-hydroxybutyl)piperidin-1-yl]acetonitrile (PubChem CID 83993358) has the molecular formula C13H23F2N3O and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethylamino)-5-(2-hydroxybutyl)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[3-(2,2-difluoroethylamino)-5-(2-hydroxybutyl)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 83993358 |
| Molecular Formula | C13H23F2N3O |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 2-[3-(2,2-difluoroethylamino)-5-(2-hydroxybutyl)piperidin-1-yl]acetonitrile |
| SMILES | CCC(O)CC1CC(NCC(F)F)CN(CC#N)C1 |
| InChI | InChI=1S/C13H23F2N3O/c1-2-12(19)6-10-5-11(17-7-13(14)15)9-18(8-10)4-3-16/h10-13,17,19H,2,4-9H2,1H3 |
| InChIKey | YFNNGVJCFUHYQM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|