C16H21F2N3 — CID 83993345
2-[3-benzyl-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile (PubChem CID 83993345) has the molecular formula C16H21F2N3 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[3-benzyl-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[3-benzyl-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 83993345 |
| Molecular Formula | C16H21F2N3 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[3-benzyl-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CC(Cc2ccccc2)CC(NCC(F)F)C1 |
| InChI | InChI=1S/C16H21F2N3/c17-16(18)10-20-15-9-14(11-21(12-15)7-6-19)8-13-4-2-1-3-5-13/h1-5,14-16,20H,7-12H2 |
| InChIKey | QFHZJZZJMBBAEY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|