C20H29N3 — CID 83999569
2-[3-benzyl-5-(cyclohexylamino)piperidin-1-yl]acetonitrile (PubChem CID 83999569) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[3-benzyl-5-(cyclohexylamino)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[3-benzyl-5-(cyclohexylamino)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 83999569 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 2-[3-benzyl-5-(cyclohexylamino)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CC(Cc2ccccc2)CC(NC2CCCCC2)C1 |
| InChI | InChI=1S/C20H29N3/c21-11-12-23-15-18(13-17-7-3-1-4-8-17)14-20(16-23)22-19-9-5-2-6-10-19/h1,3-4,7-8,18-20,22H,2,5-6,9-10,12-16H2 |
| InChIKey | KTKATGVAUSNQRA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|