C13H21F2N3 — CID 83993343
2-[3-(cyclopropylmethyl)-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile (PubChem CID 83993343) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[3-(cyclopropylmethyl)-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[3-(cyclopropylmethyl)-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 83993343 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-[3-(cyclopropylmethyl)-5-(2,2-difluoroethylamino)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CC(CC2CC2)CC(NCC(F)F)C1 |
| InChI | InChI=1S/C13H21F2N3/c14-13(15)7-17-12-6-11(5-10-1-2-10)8-18(9-12)4-3-16/h10-13,17H,1-2,4-9H2 |
| InChIKey | NTRFLJCNJRHHSX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|