C18H29BN2O4 — CID 68733520
[4-[[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid (PubChem CID 68733520) has the molecular formula C18H29BN2O4 and a molecular weight of 348.25 g/mol. Its IUPAC name is [4-[[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [4-[[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 68733520 |
| Molecular Formula | C18H29BN2O4 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [4-[[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid |
| SMILES | CC1CN(Cc2ccc(B(O)O)cc2)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29BN2O4/c1-13-10-20(12-15-6-8-16(9-7-15)19(23)24)11-14(2)21(13)17(22)25-18(3,4)5/h6-9,13-14,23-24H,10-12H2,1-5H3 |
| InChIKey | VKXOPXOQFUFZPP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|