C17H32N2O4 — CID 124559593
tert-butyl (2S,6S)-4-(5-methoxypentanoyl)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 124559593) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl (2S,6S)-4-(5-methoxypentanoyl)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6S)-4-(5-methoxypentanoyl)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 124559593 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | tert-butyl (2S,6S)-4-(5-methoxypentanoyl)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | COCCCCC(=O)N1C[C@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C17H32N2O4/c1-13-11-18(15(20)9-7-8-10-22-6)12-14(2)19(13)16(21)23-17(3,4)5/h13-14H,7-12H2,1-6H3/t13-,14-/m0/s1 |
| InChIKey | GPEHCBVDAQOOOQ-KBPBESRZSA-N |
| XLogP | 2.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|